7-hydroxy-5-methyl-2-(methylthio)-s-triazolo[1,5-a]pyrimidine-6-ethanol, compound with 3-amino-5-(methylthio)-s-triazole (1:1) structure
|
Common Name | 7-hydroxy-5-methyl-2-(methylthio)-s-triazolo[1,5-a]pyrimidine-6-ethanol, compound with 3-amino-5-(methylthio)-s-triazole (1:1) | ||
|---|---|---|---|---|
| CAS Number | 4734-27-4 | Molecular Weight | 370.454 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N8O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(2-Hydroxyethyl)-5-methyl-2-(methylsulfanyl)[1,2,4]triazolo[1,5-a]pyrimidin-7(1H)-one-3-(methylsulfanyl)-1H-1,2,4-triazol-5-amine (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18N8O2S2 |
|---|---|
| Molecular Weight | 370.454 |
| Exact Mass | 370.099426 |
| InChIKey | GYAQCPVYDHAICQ-UHFFFAOYSA-N |
| SMILES | CSc1n[nH]c(N)n1.CSc1nc2nc(C)c(CCO)c(=O)n2[nH]1 |
| EINECS 225-242-6 |
| [1,2,4]Triazolo[1,5-a]pyrimidin-7(1H)-one, 6-(2-hydroxyethyl)-5-methyl-2-(methylthio)-, compd. with 3-(methylthio)-1H-1,2,4-triazol-5-amine (1:1) |
| 6-(2-Hydroxyethyl)-5-methyl-2-(methylsulfanyl)[1,2,4]triazolo[1,5-a]pyrimidin-7(1H)-one - 3-(methylsulfanyl)-1H-1,2,4-triazol-5-amine (1:1) |