N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline
N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline structure
|
Common Name | N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 4735-73-3 | Molecular Weight | 255.35500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline, Chinese name: N-乙基-3-甲基-N-(2-苯氧乙基)安替比林, CAS number: 4735-73-3, molecular formula: C17H21NO, molecular weight: 255.35500, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H21NO |
|---|---|
| Molecular Weight | 255.35500 |
| Exact Mass | 255.16200 |
| PSA | 12.47000 |
| LogP | 3.90030 |
| InChIKey | UWVMHXIVQNNZMB-UHFFFAOYSA-N |
| SMILES | CCN(CCOc1ccccc1)c1cccc(C)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:102-27-2This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline? |
| A: CAS number of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline is 4735-73-3. |
| Q: What is the SMILES notation of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline? |
| A: SMILES notation of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline is CCN(CCOc1ccccc1)c1cccc(C)c1. |
| Q: What is the polar surface area (PSA) of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline? |
| A: Polar surface area (PSA) of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline is 12.47000. |
| Q: What is the InChIKey of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline? |
| A: InChIKey of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline is UWVMHXIVQNNZMB-UHFFFAOYSA-N. |
| Q: What is the English name of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline? |
| A: The English name of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline is N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline. |
| Q: What is the molecular formula of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline? |
| A: Molecular formula of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline is C17H21NO. |
| Q: What is the LogP of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline? |
| A: LogP of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline is 3.90030. |
| Q: What is the Chinese name of 4735-73-3? |
| A: Chinese name of 4735-73-3 is 4735-73-3. |
| Q: What are the downstream products of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline? |
| A: Related downstream products(CAS) of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline: 102-27-2. |
| Q: What is the molecular weight of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline? |
| A: Molecular weight of N-ethyl-3-methyl-N-(2-phenoxyethyl)aniline is 255.35500. |