oxazine-1
oxazine-1 structure
|
Common Name | oxazine-1 | ||
|---|---|---|---|---|
| CAS Number | 47367-75-9 | Molecular Weight | 324.44000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26N3O+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | oxazine-1 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H26N3O+ |
|---|---|
| Molecular Weight | 324.44000 |
| Exact Mass | 324.20800 |
| PSA | 32.51000 |
| LogP | 4.95450 |
| InChIKey | OELZFJUWWFRWLC-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc2nc3ccc(=[N+](CC)CC)cc-3oc2c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:53342-54-4
CAS#:62671-94-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of oxazine-1? |
| A: LogP of oxazine-1 is 4.95450. |
| Q: What is the molecular weight of oxazine-1? |
| A: Molecular weight of oxazine-1 is 324.44000. |
| Q: What is the molecular formula of oxazine-1? |
| A: Molecular formula of oxazine-1 is C20H26N3O+. |
| Q: What is the Chinese name of 47367-75-9? |
| A: Chinese name of 47367-75-9 is 47367-75-9. |
| Q: What is the English name of oxazine-1? |
| A: The English name of oxazine-1 is oxazine-1. |
| Q: What is the CAS number of oxazine-1? |
| A: CAS number of oxazine-1 is 47367-75-9. |
| Q: What are the downstream products of oxazine-1? |
| A: Related downstream products(CAS) of oxazine-1: 53342-54-4;62671-94-7. |
| Q: What is the polar surface area (PSA) of oxazine-1? |
| A: Polar surface area (PSA) of oxazine-1 is 32.51000. |
| Q: What is the InChIKey of oxazine-1? |
| A: InChIKey of oxazine-1 is OELZFJUWWFRWLC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of oxazine-1? |
| A: SMILES notation of oxazine-1 is CCN(CC)c1ccc2nc3ccc(=[N+](CC)CC)cc-3oc2c1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Henan Tianfu Chemical Co., Ltd. |