LMP-420 structure
|
Common Name | LMP-420 | ||
|---|---|---|---|---|
| CAS Number | 473870-63-2 | Molecular Weight | 283.52200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15BClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LMP-420A small-molecule, orally active inhibitor of TNF-α that reduces replication of HIV-1 (IC50=300 nM) and Mycobacterium tuberculosis in human cells. |
| Name | 5-(2-amino-6-chloropurin-9-yl)pentylboronic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H15BClN5O2 |
|---|---|
| Molecular Weight | 283.52200 |
| Exact Mass | 283.10100 |
| PSA | 110.81000 |
| LogP | 0.63510 |
| InChIKey | SPLHPRPQTCQRGZ-UHFFFAOYSA-N |
| SMILES | Nc1nc(Cl)c2ncn(CCCCCB(O)O)c2n1 |
| lmp-420 |