(8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium
Modify Date: 2026-08-08 18:54:30
(8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium structure
|
Common Name | (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium | ||
|---|---|---|---|---|
| CAS Number | 47423-71-2 | Molecular Weight | 339.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H27N2O2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H27N2O2+ |
|---|---|
| Molecular Weight | 339.5 |
| InChIKey | SJTSZVLGFLZBFK-UIHPHKDJSA-N |
| SMILES | C=CC1C[N+]2(C)CCC1CC2C(O)c1ccnc2ccc(OC)cc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium? |
| A: The English name of (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium is (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium. |
| Q: What is the Chinese name of 47423-71-2? |
| A: Chinese name of 47423-71-2 is 47423-71-2. |
| Q: What is the molecular weight of (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium? |
| A: Molecular weight of (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium is 339.5. |
| Q: What is the InChIKey of (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium? |
| A: InChIKey of (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium is SJTSZVLGFLZBFK-UIHPHKDJSA-N. |
| Q: What is the CAS number of (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium? |
| A: CAS number of (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium is 47423-71-2. |
| Q: What is the SMILES notation of (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium? |
| A: SMILES notation of (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium is C=CC1C[N+]2(C)CCC1CC2C(O)c1ccnc2ccc(OC)cc12. |
| Q: What is the molecular formula of (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium? |
| A: Molecular formula of (8I+/-,9R)-9-Hydroxy-6a(2)-methoxy-1-methylcinchonanium is C21H27N2O2+. |