N-(3-aminophenyl)-N'-benzylurea
Modify Date: 2026-07-06 11:35:08
N-(3-aminophenyl)-N'-benzylurea structure
|
Common Name | N-(3-aminophenyl)-N'-benzylurea | ||
|---|---|---|---|---|
| CAS Number | 474352-98-2 | Molecular Weight | 241.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-aminophenyl)-N'-benzylurea |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15N3O |
|---|---|
| Molecular Weight | 241.29 |
| InChIKey | GLVXUCWHPHKNAX-UHFFFAOYSA-N |
| SMILES | Nc1cccc(NC(=O)NCc2ccccc2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(3-aminophenyl)-N'-benzylurea? |
| A: CAS number of N-(3-aminophenyl)-N'-benzylurea is 474352-98-2. |
| Q: What is the molecular formula of N-(3-aminophenyl)-N'-benzylurea? |
| A: Molecular formula of N-(3-aminophenyl)-N'-benzylurea is C14H15N3O. |
| Q: What is the Chinese name of 474352-98-2? |
| A: Chinese name of 474352-98-2 is 474352-98-2. |
| Q: What is the English name of N-(3-aminophenyl)-N'-benzylurea? |
| A: The English name of N-(3-aminophenyl)-N'-benzylurea is N-(3-aminophenyl)-N'-benzylurea. |
| Q: What is the molecular weight of N-(3-aminophenyl)-N'-benzylurea? |
| A: Molecular weight of N-(3-aminophenyl)-N'-benzylurea is 241.29. |
| Q: What is the InChIKey of N-(3-aminophenyl)-N'-benzylurea? |
| A: InChIKey of N-(3-aminophenyl)-N'-benzylurea is GLVXUCWHPHKNAX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-(3-aminophenyl)-N'-benzylurea? |
| A: SMILES notation of N-(3-aminophenyl)-N'-benzylurea is Nc1cccc(NC(=O)NCc2ccccc2)c1. |