Tris(2-methoxyphenyl)phosphine oxide
Modify Date: 2026-07-08 10:30:17
Tris(2-methoxyphenyl)phosphine oxide structure
|
Common Name | Tris(2-methoxyphenyl)phosphine oxide | ||
|---|---|---|---|---|
| CAS Number | 47467-89-0 | Molecular Weight | 368.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tris(2-methoxyphenyl)phosphine oxide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H21O4P |
|---|---|
| Molecular Weight | 368.4 |
| InChIKey | HKCUQWYESZMLMF-UHFFFAOYSA-N |
| SMILES | COc1ccccc1P(=O)(c1ccccc1OC)c1ccccc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Tris(2-methoxyphenyl)phosphine oxide? |
| A: SMILES notation of Tris(2-methoxyphenyl)phosphine oxide is COc1ccccc1P(=O)(c1ccccc1OC)c1ccccc1OC. |
| Q: What is the InChIKey of Tris(2-methoxyphenyl)phosphine oxide? |
| A: InChIKey of Tris(2-methoxyphenyl)phosphine oxide is HKCUQWYESZMLMF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 47467-89-0? |
| A: Chinese name of 47467-89-0 is 47467-89-0. |
| Q: What is the molecular formula of Tris(2-methoxyphenyl)phosphine oxide? |
| A: Molecular formula of Tris(2-methoxyphenyl)phosphine oxide is C21H21O4P. |
| Q: What is the molecular weight of Tris(2-methoxyphenyl)phosphine oxide? |
| A: Molecular weight of Tris(2-methoxyphenyl)phosphine oxide is 368.4. |
| Q: What is the CAS number of Tris(2-methoxyphenyl)phosphine oxide? |
| A: CAS number of Tris(2-methoxyphenyl)phosphine oxide is 47467-89-0. |
| Q: What is the English name of Tris(2-methoxyphenyl)phosphine oxide? |
| A: The English name of Tris(2-methoxyphenyl)phosphine oxide is Tris(2-methoxyphenyl)phosphine oxide. |