Isolaureline structure
|
Common Name | Isolaureline | ||
|---|---|---|---|---|
| CAS Number | 475-84-3 | Molecular Weight | 309.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IsolaurelineIsolaureline can be isolated from the whole plant of Stephania longa[1]. |
| Name | R-(-)-N-methylxylopine |
|---|---|
| Synonym | More Synonyms |
| Description | Isolaureline can be isolated from the whole plant of Stephania longa[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H19NO3 |
|---|---|
| Molecular Weight | 309.36 |
| Exact Mass | 309.13600 |
| PSA | 30.93000 |
| LogP | 3.11390 |
| InChIKey | GXFOBPWUVXXUIF-OAHLLOKOSA-N |
| SMILES | COc1ccc2c(c1)CC1c3c(cc4c(c3-2)OCO4)CCN1C |
| (R)-10-Methoxy-7-methyl-6,7,7a,8-tetrahydro-5H-benzo[g][1,3]dioxolo[4',5':4,5]benzo[1,2,3-de]quinoline |
| (-)-isolaureline |
| isolaureline |
| (-)-Isolaurelin |