2-(N-(1-phenylethyl)carbamimidoyl)guanidine structure
|
Common Name | 2-(N-(1-phenylethyl)carbamimidoyl)guanidine | ||
|---|---|---|---|---|
| CAS Number | 4751-77-3 | Molecular Weight | 241.72100 | |
| Density | 1.25g/cm3 | Boiling Point | 388.6ºC at 760 mmHg | |
| Molecular Formula | C10H16ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.8ºC | |
| Name | 1-(diaminomethylidene)-2-(1-phenylethyl)guanidine,hydrochloride |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 388.6ºC at 760 mmHg |
| Molecular Formula | C10H16ClN5 |
| Molecular Weight | 241.72100 |
| Flash Point | 188.8ºC |
| Exact Mass | 241.10900 |
| PSA | 97.78000 |
| LogP | 3.23860 |
| Index of Refraction | 1.621 |
| InChIKey | ATOZHCWQYQOMHQ-UHFFFAOYSA-N |
| SMILES | CC(N=C(N)N=C(N)N)c1ccccc1.Cl |
|
~%
2-(N-(1-phenyle... CAS#:4751-77-3 |
| Literature: Shapiro et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3725,3726 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |