4-[1-(4-hydroxy-3-methylphenyl)propyl]-2-methylphenol structure
|
Common Name | 4-[1-(4-hydroxy-3-methylphenyl)propyl]-2-methylphenol | ||
|---|---|---|---|---|
| CAS Number | 4754-64-7 | Molecular Weight | 256.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[1-(4-hydroxy-3-methylphenyl)propyl]-2-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H20O2 |
|---|---|
| Molecular Weight | 256.33900 |
| Exact Mass | 256.14600 |
| PSA | 40.46000 |
| LogP | 4.25650 |
| InChIKey | PCEGZYGZEBCJCU-UHFFFAOYSA-N |
| SMILES | CCC(c1ccc(O)c(C)c1)c1ccc(O)c(C)c1 |
|
~%
4-[1-(4-hydroxy... CAS#:4754-64-7 |
| Literature: Harden; Reid Journal of the American Chemical Society, 1932 , vol. 54, p. 4325,4327, 4331 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,2'-dimethyl-4,4'-propylidene-di-phenol |
| 2,2'-Dimethyl-4,4'-propyliden-di-phenol |