methyl (E)-3-methoxy-2-[2-(6-methoxypyrimidin-4-yl)oxyphenyl]prop-2-enoate structure
|
Common Name | methyl (E)-3-methoxy-2-[2-(6-methoxypyrimidin-4-yl)oxyphenyl]prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 475479-10-8 | Molecular Weight | 316.309 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 475.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.3±28.7 °C | |
| Name | methyl (E)-3-methoxy-2-[2-(6-methoxypyrimidin-4-yl)oxyphenyl]prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 475.4±45.0 °C at 760 mmHg |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.309 |
| Flash Point | 241.3±28.7 °C |
| Exact Mass | 316.105927 |
| PSA | 79.77000 |
| LogP | 2.62 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | MAZIPIWGXDROTF-FMIVXFBMSA-N |
| SMILES | COC=C(C(=O)OC)c1ccccc1Oc1cc(OC)ncn1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| BEN382 |
| Benzeneacetic acid, α-(methoxymethylene)-2-[(6-methoxy-4-pyrimidinyl)oxy]-, methyl ester, (αE)- |
| Methyl (2E)-3-methoxy-2-{2-[(6-methoxy-4-pyrimidinyl)oxy]phenyl}acrylate |
| Benzeneacetic acid,|A-(methoxymethylene)-2-[(6-methoxy-4-pyrimidinyl)oxy]-,methyl ester,(|AE) |
| (E)-Methyl 3-methoxy-2-(2-((6-methoxypyrimidin-4-yl)oxy)phenyl)acrylate |