Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (R)-cyano(3-phenoxyphenyl)methyl ester, (1S,3S)-rel-, mixt. with N-[[(3,5-dichloro-2,4-difluorophenyl)amino]carbonyl]-2,6-difluorobenzamide structure
|
Common Name | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (R)-cyano(3-phenoxyphenyl)methyl ester, (1S,3S)-rel-, mixt. with N-[[(3,5-dichloro-2,4-difluorophenyl)amino]carbonyl]-2,6-difluorobenzamide | ||
|---|---|---|---|---|
| CAS Number | 475999-78-1 | Molecular Weight | 797.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H25Cl4F4N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (R)-cyano(3-phenoxyphenyl)methyl ester, (1S,3S)-rel-, mixt. with N-[[(3,5-dichloro-2,4-difluorophenyl)amino]carbonyl]-2,6-difluorobenzamide |
|---|
| Molecular Formula | C36H25Cl4F4N3O5 |
|---|---|
| Molecular Weight | 797.4 |
| InChIKey | DYSXTDXHXYRVBF-LLSKDXDJSA-N |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1.O=C(NC(=O)c1c(F)cccc1F)Nc1cc(Cl)c(F)c(Cl)c1F |