N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide structure
|
Common Name | N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 476355-36-9 | Molecular Weight | 640.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H24N4O2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C36H24N4O2S3 |
|---|---|
| Molecular Weight | 640.8 |
| InChIKey | YQAWZYOXQBWPCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=N2)NC(=O)C3=CC=C(S3)C(=O)NC4=NC(=C(S4)C5=CC=CC=C5)C6=CC=CC=C6)C7=CC=CC=C7 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide? |
| A: The English name of N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide is N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide. |
| Q: What is the molecular weight of N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide? |
| A: Molecular weight of N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide is 640.8. |
| Q: What is the InChIKey of N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide? |
| A: InChIKey of N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide is YQAWZYOXQBWPCP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide? |
| A: SMILES notation of N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide is C1=CC=C(C=C1)C2=C(SC(=N2)NC(=O)C3=CC=C(S3)C(=O)NC4=NC(=C(S4)C5=CC=CC=C5)C6=CC=CC=C6)C7=CC=CC=C7. |
| Q: What is the Chinese name of 476355-36-9? |
| A: Chinese name of 476355-36-9 is 476355-36-9. |
| Q: What is the CAS number of N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide? |
| A: CAS number of N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide is 476355-36-9. |
| Q: What is the molecular formula of N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide? |
| A: Molecular formula of N2,N5-bis(4,5-diphenylthiazol-2-yl)thiophene-2,5-dicarboxamide is C36H24N4O2S3. |