bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate
Modify Date: 2026-08-21 07:12:52
bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate structure
|
Common Name | bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 476355-87-0 | Molecular Weight | 466.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H14N2O4S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H14N2O4S3 |
|---|---|
| Molecular Weight | 466.6 |
| InChIKey | MJJQQICNRDJTFS-UHFFFAOYSA-N |
| SMILES | O=C(OCc1nc2ccccc2s1)c1ccc(C(=O)OCc2nc3ccccc3s2)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate? |
| A: Molecular weight of bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate is 466.6. |
| Q: What is the Chinese name of 476355-87-0? |
| A: Chinese name of 476355-87-0 is 476355-87-0. |
| Q: What is the English name of bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate? |
| A: The English name of bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate is bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate. |
| Q: What is the CAS number of bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate? |
| A: CAS number of bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate is 476355-87-0. |
| Q: What is the molecular formula of bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate? |
| A: Molecular formula of bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate is C22H14N2O4S3. |
| Q: What is the SMILES notation of bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate? |
| A: SMILES notation of bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate is O=C(OCc1nc2ccccc2s1)c1ccc(C(=O)OCc2nc3ccccc3s2)s1. |
| Q: What is the InChIKey of bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate? |
| A: InChIKey of bis(1,3-benzothiazol-2-ylmethyl) thiophene-2,5-dicarboxylate is MJJQQICNRDJTFS-UHFFFAOYSA-N. |