Ethyl (1-methyl-2-oxo-1,2-dihydro-4-quinolinyl)acetate structure
|
Common Name | Ethyl (1-methyl-2-oxo-1,2-dihydro-4-quinolinyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 4764-81-2 | Molecular Weight | 245.27400 | |
| Density | 1.172g/cm3 | Boiling Point | 351.3ºC at 760 mmHg | |
| Molecular Formula | C14H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.3ºC | |
| Name | ethyl 2-(1-methyl-2-oxoquinolin-4-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 351.3ºC at 760 mmHg |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.27400 |
| Flash Point | 166.3ºC |
| Exact Mass | 245.10500 |
| PSA | 48.30000 |
| LogP | 1.64410 |
| Index of Refraction | 1.551 |
| InChIKey | WIYRSCZSIYKHOK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1cc(=O)n(C)c2ccccc12 |
|
~%
Ethyl (1-methyl... CAS#:4764-81-2 |
| Literature: Kaslow; Cook Journal of the American Chemical Society, 1945 , vol. 67, p. 1969,1972 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Ethyl (1-methyl-2-oxo-1,2-dihydro-4-quinolinyl)acetate |
| 1-Methyl-4-ethoxycarbonylmethyl-carbostyril |
| (1-Methyl-2-oxo-1,2-dihydro-[4]chinolyl)-essigsaeure-aethylester |
| (1-methyl-2-oxo-1,2-dihydro-[4]quinolyl)-acetic acid ethyl ester |