N-(2,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)acetamide structure
|
Common Name | N-(2,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 4766-93-2 | Molecular Weight | 269.29000 | |
| Density | 1.249g/cm3 | Boiling Point | 398ºC at 760 mmHg | |
| Molecular Formula | C13H17F2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.5ºC | |
| Name | N-(2,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 398ºC at 760 mmHg |
| Molecular Formula | C13H17F2N3O |
| Molecular Weight | 269.29000 |
| Flash Point | 194.5ºC |
| Exact Mass | 269.13400 |
| PSA | 39.07000 |
| LogP | 1.67600 |
| Index of Refraction | 1.551 |
| InChIKey | CPEDISWKSLLPRD-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC(=O)Nc2ccc(F)cc2F)CC1 |
|
~%
N-(2,4-difluoro... CAS#:4766-93-2 |
| Literature: Radecki,A. et al. Roczniki Chemii, 1965 , vol. 39, p. 819 - 826 |
|
~%
N-(2,4-difluoro... CAS#:4766-93-2 |
| Literature: Post; Norton Journal of Organic Chemistry, 1942 , vol. 7, p. 530 |
|
~%
Detail
|
| Literature: Post; Norton Journal of Organic Chemistry, 1942 , vol. 7, p. 530 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Brom-tributoxy-silan |
| bromo-tributoxy-silane |
| Brom-tributyloxy-silan |
| Tributoxy-brom-silan |