7-(benzyloxy)-4-bromo-1h-indole structure
|
Common Name | 7-(benzyloxy)-4-bromo-1h-indole | ||
|---|---|---|---|---|
| CAS Number | 476622-92-1 | Molecular Weight | 302.16600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-bromo-7-benzyloxy-1h-indole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12BrNO |
|---|---|
| Molecular Weight | 302.16600 |
| Exact Mass | 301.01000 |
| PSA | 25.02000 |
| LogP | 4.50940 |
| InChIKey | HWDMSYHNPIYTJF-UHFFFAOYSA-N |
| SMILES | Brc1ccc(OCc2ccccc2)c2[nH]ccc12 |
|
~33%
7-(benzyloxy)-4... CAS#:476622-92-1 |
| Literature: Garg, Neil K.; Sarpong, Richmond; Stoltz, Brian M. Journal of the American Chemical Society, 2002 , vol. 124, # 44 p. 13179 - 13184 |
|
~%
7-(benzyloxy)-4... CAS#:476622-92-1 |
| Literature: BIOVITRUM AB (publ) Patent: WO2008/3703 A1, 2008 ; Location in patent: Page/Page column 132 ; WO 2008/003703 A1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 7-(benzyloxy)-4-bromo-1H-indole |
| 7-benzyloxy-4-bromoindole |
| 1H-Indole,4-broMo-7-(phenylMethoxy) |