1-(5-nitroindol-1-yl)ethanone structure
|
Common Name | 1-(5-nitroindol-1-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 4769-98-6 | Molecular Weight | 204.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(5-nitroindol-1-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8N2O3 |
|---|---|
| Molecular Weight | 204.18200 |
| Exact Mass | 204.05300 |
| PSA | 67.82000 |
| LogP | 2.73280 |
| InChIKey | OQCZYNYPYKRBSZ-UHFFFAOYSA-N |
| SMILES | CC(=O)n1ccc2cc([N+](=O)[O-])ccc21 |
|
~73%
1-(5-nitroindol... CAS#:4769-98-6 |
| Literature: Phipps, Robert J.; Grimster, Neil P.; Gaunt, Matthew J. Journal of the American Chemical Society, 2008 , vol. 130, # 26 p. 8172 - 8174 |
| 1-acetyl-5-nitro-indole |
| 1-acetyl-5-nitro-1H-indole |
| 1-Acetyl-5-nitro-indol |
| N-Acetyl-5-nitroindol |
| 1H-Indole,1-acetyl-5-nitro |
| N-acetyl-5-nitroindole |