Picropodopyllotoxone structure
|
Common Name | Picropodopyllotoxone | ||
|---|---|---|---|---|
| CAS Number | 477-48-5 | Molecular Weight | 412.38900 | |
| Density | N/A | Boiling Point | 602.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H20O8 | Melting Point | 153-154 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of PicropodopyllotoxonePicropodophyllone, an aryltetralin lignan, is isolated from leaves of Podophyllum hexandrum, and has antifungal activities[1][2]. |
| Name | PPPone |
|---|---|
| Synonym | More Synonyms |
| Description | Picropodophyllone, an aryltetralin lignan, is isolated from leaves of Podophyllum hexandrum, and has antifungal activities[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 602.3±55.0 °C at 760 mmHg |
|---|---|
| Melting Point | 153-154 °C |
| Molecular Formula | C22H20O8 |
| Molecular Weight | 412.38900 |
| Exact Mass | 412.11600 |
| PSA | 89.52000 |
| LogP | 2.55850 |
| InChIKey | ISCQYPPCSYRZOT-MJXNMMHHSA-N |
| SMILES | COc1cc(C2c3cc4c(cc3C(=O)C3COC(=O)C32)OCO4)cc(OC)c1OC |
| Storage condition | 2-8°C |
| (5aR,8aS,9R)-9-(3,4,5-Trimethoxy-phenyl)-5a,6,8a,9-tetrahydro-furo[3',4':6,7]naphtho[2,3-d][1,3]dioxole-5,8-dione |
| Picropodophyllon |
| (5aR,8aS,9R)-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxole-5,8-dione |
| picropodophyllone |
| (11S,15S)-16-(3,4,5-trimethoxyphenyl)-4,6,13-trioxatetracyclo[7.7.0.0^{3,7}.0^{11,15}]hexadeca-1,3(7),8-trien-10,14-dione |
| (11S,15S)-16-10-(3,4,5-trimethoxyphenyl)-4,6,13-trioxatetracyclo[7.7.0.0^{3,7}.0^{11,15}]hexadeca-1,3(7),8-trien-10,14-dione |