Dimethoxanate
Dimethoxanate structure
|
Common Name | Dimethoxanate | ||
|---|---|---|---|---|
| CAS Number | 477-93-0 | Molecular Weight | 358.45500 | |
| Density | 1.234g/cm3 | Boiling Point | 494ºC at 760mmHg | |
| Molecular Formula | C19H22N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 494ºC at 760mmHg |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.45500 |
| Flash Point | 252.6ºC |
| Exact Mass | 358.13500 |
| PSA | 67.31000 |
| LogP | 4.06910 |
| Vapour Pressure | 6.7E-10mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | OOVJCSPCMCAXEX-UHFFFAOYSA-N |
| SMILES | CN(C)CCOCCOC(=O)N1c2ccccc2Sc2ccccc21 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Dimethoxanate [INN:BAN] |
| Dimethoxanate |
| Dimethoxanate (INN) |
| Tussidin |
| Dimethoxanatum [INN-Latin] |
| Dimethoxanatum |
| Phenothiazin-N-carbonsaeure-<2-(2-dimethylamino-aethoxy)-aethylester |
| UNII-1E3KG5FWDB |
| phenothiazine-10-carboxylic acid 2-(2-dimethylamino-ethoxy)-ethyl ester |
| Phenothiazin-carbonsaeure-(10)-<2-(2-dimethylamino-aethoxy)-aethylester |
| Dimetoxanato |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate? |
| A: CAS number of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate is 477-93-0. |
| Q: What is the molecular formula of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate? |
| A: Molecular formula of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate is C19H22N2O3S. |
| Q: What English synonyms does 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate have? |
| A: English synonyms of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate: Dimethoxanate [INN:BAN], Dimethoxanate, Dimethoxanate (INN), Tussidin, Dimethoxanatum [INN-Latin], Dimethoxanatum, Phenothiazin-N-carbonsaeure-<2-(2-dimethylamino-aethoxy)-aethylester, UNII-1E3KG5FWDB, phenothiazine-10-carboxylic acid 2-(2-dimethylamino-ethoxy)-ethyl ester, Phenothiazin-carbonsaeure-(10)-<2-(2-dimethylamino-aethoxy)-aethylester, Dimetoxanato. |
| Q: What is the SMILES notation of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate? |
| A: SMILES notation of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate is CN(C)CCOCCOC(=O)N1c2ccccc2Sc2ccccc21. |
| Q: What is the boiling point of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate? |
| A: Boiling point of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate is 494ºC at 760mmHg. |
| Q: What is the InChIKey of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate? |
| A: InChIKey of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate is OOVJCSPCMCAXEX-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate? |
| A: Molecular weight of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate is 358.45500. |
| Q: What is the LogP of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate? |
| A: LogP of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate is 4.06910. |
| Q: What is the English name of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate? |
| A: The English name of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate is 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate. |
| Q: What is the polar surface area (PSA) of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate? |
| A: Polar surface area (PSA) of 2-[2-(dimethylamino)ethoxy]ethyl phenothiazine-10-carboxylate is 67.31000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |