2-(3-oxo-1H-isoindol-2-yl)benzoic acid structure
|
Common Name | 2-(3-oxo-1H-isoindol-2-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 4770-69-8 | Molecular Weight | 253.25300 | |
| Density | 1.385g/cm3 | Boiling Point | 483.1ºC at 760 mmHg | |
| Molecular Formula | C15H11NO3 | Melting Point | 240-243ºC | |
| MSDS | N/A | Flash Point | 246ºC | |
| Name | 2-(3-oxo-1H-isoindol-2-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.385g/cm3 |
|---|---|
| Boiling Point | 483.1ºC at 760 mmHg |
| Melting Point | 240-243ºC |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.25300 |
| Flash Point | 246ºC |
| Exact Mass | 253.07400 |
| PSA | 57.61000 |
| LogP | 2.61020 |
| Index of Refraction | 1.677 |
| InChIKey | ABKBCHBYNDGPLH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1N1Cc2ccccc2C1=O |
| HS Code | 2918300090 |
|---|
|
~57%
2-(3-oxo-1H-iso... CAS#:4770-69-8 |
| Literature: Chen, Yun; Li, Hui; Cai, Shuanglian Chemical Communications, 2009 , # 36 p. 5392 - 5393 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-(1-oxoisoindolin-2-yl)benzoic acid |
| 2-(1-oxo-1H-2,3-dihydroisoindol-2-yl)benzoic acid |
| 2-(o-Carboxy-phenyl)-phthalimidin |
| 2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)benzenecarboxylic acid |
| 2-(1-oxo-1,3-dihydro-isoindol-2-yl)-benzoic acid |
| 2,6-DICHLORO-4-NITROFLUOROBENZENE |
| 2-(1-oxo-1H-2,3-dihydroisoindol-2-yl)benzonic acid |