(Z)-3-((2,3-dimethylphenyl)amino)-2-(4-(4-ethylphenyl)thiazol-2-yl)acrylonitrile
Modify Date: 2026-06-30 19:26:03
(Z)-3-((2,3-dimethylphenyl)amino)-2-(4-(4-ethylphenyl)thiazol-2-yl)acrylonitrile structure
|
Common Name | (Z)-3-((2,3-dimethylphenyl)amino)-2-(4-(4-ethylphenyl)thiazol-2-yl)acrylonitrile | ||
|---|---|---|---|---|
| CAS Number | 477186-89-3 | Molecular Weight | 359.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (Z)-3-((2,3-dimethylphenyl)amino)-2-(4-(4-ethylphenyl)thiazol-2-yl)acrylonitrile |
|---|
| Molecular Formula | C22H21N3S |
|---|---|
| Molecular Weight | 359.5 |
| InChIKey | HYVFZVGMOBYRED-UYRXBGFRSA-N |
| SMILES | CCc1ccc(-c2csc(C(C#N)=CNc3cccc(C)c3C)n2)cc1 |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1