(Z)-ethyl 2-((2-cyano-2-(4-(3,4-dichlorophenyl)thiazol-2-yl)vinyl)amino)benzoate
Modify Date: 2026-06-25 11:11:42
(Z)-ethyl 2-((2-cyano-2-(4-(3,4-dichlorophenyl)thiazol-2-yl)vinyl)amino)benzoate structure
|
Common Name | (Z)-ethyl 2-((2-cyano-2-(4-(3,4-dichlorophenyl)thiazol-2-yl)vinyl)amino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 477296-47-2 | Molecular Weight | 444.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H15Cl2N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (Z)-ethyl 2-((2-cyano-2-(4-(3,4-dichlorophenyl)thiazol-2-yl)vinyl)amino)benzoate |
|---|
| Molecular Formula | C21H15Cl2N3O2S |
|---|---|
| Molecular Weight | 444.3 |
| InChIKey | KFPUAYNZLXSXED-KAMYIIQDSA-N |
| SMILES | CCOC(=O)C1=CC=CC=C1N/C=C(/C#N)\C2=NC(=CS2)C3=CC(=C(C=C3)Cl)Cl |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1