Benzamide,3,5-dibromo-2-hydroxy-N-[3-(trifluoromethyl)phenyl]- structure
|
Common Name | Benzamide,3,5-dibromo-2-hydroxy-N-[3-(trifluoromethyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 4776-06-1 | Molecular Weight | 439.02200 | |
| Density | 1.887g/cm3 | Boiling Point | 371.4ºC at 760mmHg | |
| Molecular Formula | C14H8Br2F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.4ºC | |
| Name | 3,5-dibromo-2-hydroxy-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.887g/cm3 |
|---|---|
| Boiling Point | 371.4ºC at 760mmHg |
| Molecular Formula | C14H8Br2F3NO2 |
| Molecular Weight | 439.02200 |
| Flash Point | 178.4ºC |
| Exact Mass | 436.88700 |
| PSA | 49.33000 |
| LogP | 5.26130 |
| Index of Refraction | 1.632 |
| InChIKey | VYKKDKFTDMVOBU-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1cc(Br)cc(Br)c1O |
CHEMICAL IDENTIFICATION
|
|
~%
Benzamide,3,5-d... CAS#:4776-06-1 |
| Literature: Coburn; Batista; Evans; Genco Journal of Medicinal Chemistry, 1981 , vol. 24, # 10 p. 1245 - 1249 |
|
~%
Benzamide,3,5-d... CAS#:4776-06-1 |
| Literature: Coburn; Batista; Evans; Genco Journal of Medicinal Chemistry, 1981 , vol. 24, # 10 p. 1245 - 1249 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Flusalanum |
| Vancide FP |
| FLUOROSALAN |
| Caswell No. 290 |
| Fluorsalan |
| Fluorophene |
| Flusalan |