N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide
Modify Date: 2026-08-23 11:39:22
N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide structure
|
Common Name | N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 477775-15-8 | Molecular Weight | 475.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H29N3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H29N3O4S2 |
|---|---|
| Molecular Weight | 475.6 |
| InChIKey | UZDLZKANCYDPSR-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1ccc(Cn2ccnc2)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Displacement of [125I]Ang2 from AT2 receptor in pig uterus membrane
Source: ChEMBL
Target: Type-2 angiotensin II receptor
External Id: CHEMBL907246
|
|
Name: Displacement of [125I]Ang2 from AT2 receptor in rat liver membrane
Source: ChEMBL
Target: Type-2 angiotensin II receptor
External Id: CHEMBL907245
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide? |
| A: CAS number of N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide is 477775-15-8. |
| Q: What is the InChIKey of N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide? |
| A: InChIKey of N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide is UZDLZKANCYDPSR-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide? |
| A: Molecular formula of N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide is C23H29N3O4S2. |
| Q: What is the SMILES notation of N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide? |
| A: SMILES notation of N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide is CC(C)COC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1ccc(Cn2ccnc2)cc1. |
| Q: What is the Chinese name of 477775-15-8? |
| A: Chinese name of 477775-15-8 is 477775-15-8. |
| Q: What is the molecular weight of N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide? |
| A: Molecular weight of N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide is 475.6. |
| Q: What is the English name of N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide? |
| A: The English name of N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide is N-iso-Butyloxycarbonyl-3-(4-imidazol-1-ylmethylphenyl)-5-iso-butylthiophene-2-sulfonamide. |