2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol
Modify Date: 2026-08-19 08:32:19
![2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol Structure](https://www.chemsrc.com/extcaspic/073/478067-55-9.png)
2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol structure
|
Common Name | 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 478067-55-9 | Molecular Weight | 224.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8N2OS2 |
|---|---|
| Molecular Weight | 224.3 |
| InChIKey | QWELKKMMJMSCLJ-UHFFFAOYSA-N |
| SMILES | C=CCSc1nc2ccsc2c(=O)[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol? |
| A: InChIKey of 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol is QWELKKMMJMSCLJ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol? |
| A: Molecular weight of 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol is 224.3. |
| Q: What is the English name of 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol? |
| A: The English name of 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol is 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol. |
| Q: What is the CAS number of 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol? |
| A: CAS number of 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol is 478067-55-9. |
| Q: What is the molecular formula of 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol? |
| A: Molecular formula of 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol is C9H8N2OS2. |
| Q: What is the Chinese name of 478067-55-9? |
| A: Chinese name of 478067-55-9 is 478067-55-9. |
| Q: What is the SMILES notation of 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol? |
| A: SMILES notation of 2-(Allylsulfanyl)thieno[3,2-d]pyrimidin-4-ol is C=CCSc1nc2ccsc2c(=O)[nH]1. |