Diphenylpyraline-N-oxide hydrochloride
Modify Date: 2025-09-08 17:25:46
Diphenylpyraline-N-oxide hydrochloride structure
|
Common Name | Diphenylpyraline-N-oxide hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 4782-63-2 | Molecular Weight | 333.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Diphenylpyraline-N-oxide hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H24ClNO2 |
|---|---|
| Molecular Weight | 333.8 |
| InChIKey | NSPHEPYNPJCXAO-UHFFFAOYSA-N |
| SMILES | C[N+]1([O-])CCC(OC(c2ccccc2)c2ccccc2)CC1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 4782-63-2? |
| A: Chinese name of 4782-63-2 is 4782-63-2. |
| Q: What is the molecular formula of Diphenylpyraline-N-oxide hydrochloride? |
| A: Molecular formula of Diphenylpyraline-N-oxide hydrochloride is C19H24ClNO2. |
| Q: What is the SMILES notation of Diphenylpyraline-N-oxide hydrochloride? |
| A: SMILES notation of Diphenylpyraline-N-oxide hydrochloride is C[N+]1([O-])CCC(OC(c2ccccc2)c2ccccc2)CC1.Cl. |
| Q: What is the molecular weight of Diphenylpyraline-N-oxide hydrochloride? |
| A: Molecular weight of Diphenylpyraline-N-oxide hydrochloride is 333.8. |
| Q: What is the CAS number of Diphenylpyraline-N-oxide hydrochloride? |
| A: CAS number of Diphenylpyraline-N-oxide hydrochloride is 4782-63-2. |
| Q: What is the InChIKey of Diphenylpyraline-N-oxide hydrochloride? |
| A: InChIKey of Diphenylpyraline-N-oxide hydrochloride is NSPHEPYNPJCXAO-UHFFFAOYSA-N. |
| Q: What is the English name of Diphenylpyraline-N-oxide hydrochloride? |
| A: The English name of Diphenylpyraline-N-oxide hydrochloride is Diphenylpyraline-N-oxide hydrochloride. |