2'-Deoxyadenosine monohydrate-5′-13C structure
|
Common Name | 2'-Deoxyadenosine monohydrate-5′-13C | ||
|---|---|---|---|---|
| CAS Number | 478510-77-9 | Molecular Weight | 270.25000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2'-Deoxyadenosine monohydrate-5′-13C2'-Deoxyadenosine monohydrate-5′-13C is the 13C labeled 2'-Deoxyadenosine monohydrate. 2'-Deoxyadenosine monohydrate is a deoxyribonucleoside. A building block in the chemical synthesis[1]. |
| Name | [5'-13c]2'-deoxyadenosine monohydrate |
|---|
| Description | 2'-Deoxyadenosine monohydrate-5′-13C is the 13C labeled 2'-Deoxyadenosine monohydrate. 2'-Deoxyadenosine monohydrate is a deoxyribonucleoside. A building block in the chemical synthesis[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C10H15N5O4 |
|---|---|
| Molecular Weight | 270.25000 |
| Exact Mass | 270.11600 |
| PSA | 128.54000 |
| InChIKey | WZJWHIMNXWKNTO-JAXFXGRRSA-N |
| SMILES | Nc1ncnc2c1ncn2C1CC(O)C(CO)O1.O |