Uridine 13C-1 structure
|
Common Name | Uridine 13C-1 | ||
|---|---|---|---|---|
| CAS Number | 478511-11-4 | Molecular Weight | 245.19400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Uridine 13C-1Uridine 13C-1 is the 13C labeled Uridine[1]. |
| Name | [2'-13c]uridine |
|---|
| Description | Uridine 13C-1 is the 13C labeled Uridine[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C9H12N2O6 |
|---|---|
| Molecular Weight | 245.19400 |
| Exact Mass | 245.07300 |
| PSA | 124.78000 |
| InChIKey | DRTQHJPVMGBUCF-OGBLAGJQSA-N |
| SMILES | O=c1ccn(C2OC(CO)C(O)C2O)c(=O)[nH]1 |