Podospicatin
Modify Date: 2025-08-26 22:21:14
Podospicatin structure
|
Common Name | Podospicatin | ||
|---|---|---|---|---|
| CAS Number | 479-97-0 | Molecular Weight | 330.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Podospicatin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H14O7 |
|---|---|
| Molecular Weight | 330.29 |
| InChIKey | OJZJQMVCYJGFGG-UHFFFAOYSA-N |
| SMILES | COc1ccc(O)c(-c2coc3cc(O)c(OC)c(O)c3c2=O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 479-97-0? |
| A: Chinese name of 479-97-0 is 479-97-0. |
| Q: What is the English name of Podospicatin? |
| A: The English name of Podospicatin is Podospicatin. |
| Q: What is the molecular formula of Podospicatin? |
| A: Molecular formula of Podospicatin is C17H14O7. |
| Q: What is the InChIKey of Podospicatin? |
| A: InChIKey of Podospicatin is OJZJQMVCYJGFGG-UHFFFAOYSA-N. |
| Q: What is the CAS number of Podospicatin? |
| A: CAS number of Podospicatin is 479-97-0. |
| Q: What is the SMILES notation of Podospicatin? |
| A: SMILES notation of Podospicatin is COc1ccc(O)c(-c2coc3cc(O)c(OC)c(O)c3c2=O)c1. |
| Q: What is the molecular weight of Podospicatin? |
| A: Molecular weight of Podospicatin is 330.29. |