1,3,5,7,9,11,14-Heptacyclohexyltricyclo[7.3.3.15,11]heptasiloxane-3,7,14-triol structure
|
Common Name | 1,3,5,7,9,11,14-Heptacyclohexyltricyclo[7.3.3.15,11]heptasiloxane-3,7,14-triol | ||
|---|---|---|---|---|
| CAS Number | 47904-22-3 | Molecular Weight | 959.69200 | |
| Density | 1.18g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C42H82O11Si7 | Melting Point | 109ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 1,3,5,7,9,11,14-Heptacyclohexyltricyclo[7.3.3.15,11]heptasiloxane-3,7,14-triol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Melting Point | 109ºC(lit.) |
| Molecular Formula | C42H82O11Si7 |
| Molecular Weight | 959.69200 |
| Exact Mass | 958.42400 |
| PSA | 134.53000 |
| LogP | 10.59890 |
| Index of Refraction | 1.54 |
| InChIKey | GAUUYVMFTLBDED-UHFFFAOYSA-N |
| SMILES | O[Si]1(C2CCCCC2)O[Si]2(C3CCCCC3)O[Si](O)(C3CCCCC3)O[Si]3(C4CCCCC4)O[Si](O)(C4CCCCC4)O[Si](C4CCCCC4)(O1)O[Si](C1CCCCC1)(O2)O3 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| cyclohexylsilsesquioxane |
| 1,3,5,7,9,11,14-heptacyclohexyltricyclo[7.3.3.1(5,11)]heptasiloxaneendo-3,7,14-triol |
| Si7O9(c-C6H11)7(OH)3 |
| (c-C6H11)7Si7O9(OH)3 |
| MFCD01321343 |
| Cy7Si7O9(OH)3 |
| trisilanolcyclohexyl-POSS |