Cholecystokinin Octapeptide (2-8) (desulfated) structure
|
Common Name | Cholecystokinin Octapeptide (2-8) (desulfated) | ||
|---|---|---|---|---|
| CAS Number | 47910-79-2 | Molecular Weight | 948.11800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H57N9O10S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cholecystokinin Octapeptide (2-8) (desulfated)CCK (27-33) is the C-terminal heptapeptide of cholecystokinin (CCK)[1]. |
| Name | H-Tyr-Met-Gly-Trp-Met-Asp-Phe-NH2 (CCK-7-NS) |
|---|---|
| Synonym | More Synonyms |
| Description | CCK (27-33) is the C-terminal heptapeptide of cholecystokinin (CCK)[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C45H57N9O10S2 |
|---|---|
| Molecular Weight | 948.11800 |
| Exact Mass | 947.36700 |
| PSA | 367.63000 |
| LogP | 3.98110 |
| InChIKey | CRSGPVVFNHQALK-GIZYWFQPSA-N |
| SMILES | CSCCC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCSC)C(=O)NC(CC(=O)O)C(=O)NC(Cc1ccccc1)C(N)=O |
| tyr-met-gly-trp-met-asp-phe-nh2 |
| cholecystokinin octapeptide (2-8) (desulfated) |