3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid structure
|
Common Name | 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4792-07-8 | Molecular Weight | 594.65700 | |
| Density | 1.309g/cm3 | Boiling Point | 1176.7ºC at 760 mmHg | |
| Molecular Formula | C34H34N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 665.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.309g/cm3 |
|---|---|
| Boiling Point | 1176.7ºC at 760 mmHg |
| Molecular Formula | C34H34N4O6 |
| Molecular Weight | 594.65700 |
| Flash Point | 665.4ºC |
| Exact Mass | 594.24800 |
| PSA | 165.04000 |
| LogP | 3.00320 |
| Index of Refraction | 1.625 |
| InChIKey | JJLNCEAYNRHLSK-WNBHBUQLSA-N |
| SMILES | CC(=O)C1=C(C)C2=NC1=Cc1[nH]c(c(=C(C)O)c1C)=CC1=NC(=CC3=NC(=C2)C(C)=C3CCC(=O)O)C(CCC(=O)O)=C1C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4-diacetyldeuteroporphyrin |
| 3-[7,12-diacetyl-18-(2-carboxyethyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
| 2,4-Diacetyldeuteroporphyrin IX dimethylester |
| 31,81-Dioxo-mesoporphyrin |
| 3,3'-(7,12-diacetyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-diyl)-bis-propionic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 4792-07-8? |
| A: Chinese name of 4792-07-8 is 4792-07-8. |
| Q: What is the SMILES notation of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid? |
| A: SMILES notation of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid is CC(=O)C1=C(C)C2=NC1=Cc1[nH]c(c(=C(C)O)c1C)=CC1=NC(=CC3=NC(=C2)C(C)=C3CCC(=O)O)C(CCC(=O)O)=C1C. |
| Q: What is the CAS number of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid? |
| A: CAS number of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid is 4792-07-8. |
| Q: What is the polar surface area (PSA) of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid? |
| A: Polar surface area (PSA) of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid is 165.04000. |
| Q: What is the LogP of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid? |
| A: LogP of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid is 3.00320. |
| Q: What is the boiling point of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid? |
| A: Boiling point of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid is 1176.7ºC at 760 mmHg. |
| Q: What is the molecular formula of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid? |
| A: Molecular formula of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid is C34H34N4O6. |
| Q: What are the downstream products of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid? |
| A: Related downstream products(CAS) of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid: 10591-31-8;553-12-8;14459-29-1. |
| Q: What English synonyms does 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid have? |
| A: English synonyms of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid: 2,4-diacetyldeuteroporphyrin, 3-[7,12-diacetyl-18-(2-carboxyethyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid, 2,4-Diacetyldeuteroporphyrin IX dimethylester, 31,81-Dioxo-mesoporphyrin, 3,3'-(7,12-diacetyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-diyl)-bis-propionic acid. |
| Q: What is the InChIKey of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid? |
| A: InChIKey of 3-[8,13-diacetyl-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid is JJLNCEAYNRHLSK-WNBHBUQLSA-N. |