[5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane structure
|
Common Name | [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane | ||
|---|---|---|---|---|
| CAS Number | 4792-10-3 | Molecular Weight | 402.44100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H26N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 5,5'-Diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane (CAS: 4792-10-3), molecular formula C21H26N2O6, molecular weight 402.44100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H26N2O6 |
|---|---|
| Molecular Weight | 402.44100 |
| Exact Mass | 402.17900 |
| PSA | 118.32000 |
| LogP | 2.38660 |
| InChIKey | GBIAKEUGOCWTGS-UHFFFAOYSA-N |
| SMILES | COC(=O)CCc1[nH]c(C=O)c(C)c1Cc1c(CCC(=O)OC)[nH]c(C=O)c1C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[5,5'-diformyl-... CAS#:4792-10-3 |
| Literature: Chen; Medforth; Smith; Alderfer; Dougherty; Pandey Journal of Organic Chemistry, 2001 , vol. 66, # 11 p. 3930 - 3939 |
|
~%
[5,5'-diformyl-... CAS#:4792-10-3 |
| Literature: Robinson, John A.; McDonald, Edward; Battersby, Alan R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1699 - 1710 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 4 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,3'-di(2-methoxycarbonylethyl)-4,4'-dimethyl-2,2'-dipyrrylmethane-5,5'-dicarbaldehyde |
| 3,3'-di(2-methoxycarbonylethyl)-4,4'-dimethyl-2,2'-dipyrrylmethane-dicarbaldehyde |
| 5,5'-diformyl-4,4'-dimethyl-3,3-bis(2-(methoxycarbonyl)ethyl)-2,2'-dipyrrylmethane |
| 5,5'-diformyl-3,3'-bis(2-methoxycarbonylethyl)-4,4'-dimethyl-2,2'-methylenedipyrrole |
| 5,5'-diformyl-3,3'-bis-(2-methoxycarbonylethyl)-4,4'-dimethyl-2,2'-dipyrrylmethane |
| 3,3'-Bis(2-methoxycarbonylethyl)-4,4'-dimethyl-2,2'-dipyrrylmethane-5,5'-dicarboxaldehyde |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane? |
| A: Related upstream materials(CAS) of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane: 992-36-9;859-38-1. |
| Q: What is the molecular formula of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane? |
| A: Molecular formula of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane is C21H26N2O6. |
| Q: What is the polar surface area (PSA) of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane? |
| A: Polar surface area (PSA) of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane is 118.32000. |
| Q: What is the SMILES notation of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane? |
| A: SMILES notation of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane is COC(=O)CCc1[nH]c(C=O)c(C)c1Cc1c(CCC(=O)OC)[nH]c(C=O)c1C. |
| Q: What is the InChIKey of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane? |
| A: InChIKey of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane is GBIAKEUGOCWTGS-UHFFFAOYSA-N. |
| Q: What is the molecular weight of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane? |
| A: Molecular weight of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane is 402.44100. |
| Q: What is the LogP of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane? |
| A: LogP of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane is 2.38660. |
| Q: What is the English name of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane? |
| A: The English name of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane is [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane. |
| Q: What is the CAS number of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane? |
| A: CAS number of [5,5'-diformyl-4,4'-dimethyl-3,3'-bis[2-(methoxycarbonyl)ethyl]-2,2'-dipyrryl]methane is 4792-10-3. |
| Q: What is the Chinese name of 4792-10-3? |
| A: Chinese name of 4792-10-3 is 4792-10-3. |