1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene
![1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene Structure](https://image.chemsrc.com/caspic/380/4792-39-6.png)
1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene structure
|
Common Name | 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 4792-39-6 | Molecular Weight | 256.33900 | |
| Density | 1.022g/cm3 | Boiling Point | 370.2ºC at 760 mmHg | |
| Molecular Formula | C17H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.022g/cm3 |
|---|---|
| Boiling Point | 370.2ºC at 760 mmHg |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.33900 |
| Flash Point | 139.5ºC |
| Exact Mass | 256.14600 |
| PSA | 18.46000 |
| LogP | 4.24570 |
| Index of Refraction | 1.536 |
| InChIKey | GTTBDBMVXJOGTB-UHFFFAOYSA-N |
| SMILES | CCC(c1ccc(OC)cc1)c1ccc(OC)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
CAS#:123-38-6
CAS#:100-66-3![1-methoxy-4-[1-(4-methoxyphenyl)prop-1-enyl]benzene Structure](https://image.chemsrc.com/caspic/097/4663-13-2.png)
CAS#:4663-13-2![1-methoxy-4-[1-(4-methoxyphenyl)ethenyl]benzene Structure](https://image.chemsrc.com/caspic/183/4356-69-8.png)
CAS#:4356-69-8
CAS#:90-96-0
CAS#:4180-23-8
CAS#:7525-23-7
CAS#:597-64-8
CAS#:13139-86-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 4792-39-6? |
| A: Chinese name of 4792-39-6 is 4792-39-6. |
| Q: What is the LogP of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene? |
| A: LogP of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene is 4.24570. |
| Q: What is the English name of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene? |
| A: The English name of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene is 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene. |
| Q: What is the polar surface area (PSA) of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene? |
| A: Polar surface area (PSA) of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene is 18.46000. |
| Q: What is the molecular formula of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene? |
| A: Molecular formula of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene is C17H20O2. |
| Q: What is the boiling point of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene? |
| A: Boiling point of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene is 370.2ºC at 760 mmHg. |
| Q: What is the molecular weight of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene? |
| A: Molecular weight of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene is 256.33900. |
| Q: What is the InChIKey of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene? |
| A: InChIKey of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene is GTTBDBMVXJOGTB-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene? |
| A: Related upstream materials(CAS) of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene: 123-38-6;100-66-3;4663-13-2;4356-69-8;90-96-0;4180-23-8;7525-23-7;597-64-8;13139-86-1. |
| Q: What is the SMILES notation of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene? |
| A: SMILES notation of 1-methoxy-4-[1-(4-methoxyphenyl)propyl]benzene is CCC(c1ccc(OC)cc1)c1ccc(OC)cc1. |