(E)-ETHYL 2-((4-METHOXYPHENYL)DIAZENYL)-2-METHYL-3-OXOBUTANOATE
(E)-ETHYL 2-((4-METHOXYPHENYL)DIAZENYL)-2-METHYL-3-OXOBUTANOATE structure
|
Common Name | (E)-ETHYL 2-((4-METHOXYPHENYL)DIAZENYL)-2-METHYL-3-OXOBUTANOATE | ||
|---|---|---|---|---|
| CAS Number | 4792-56-7 | Molecular Weight | 278.304 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 353.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.8±22.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 353.9±42.0 °C at 760 mmHg |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.304 |
| Flash Point | 135.8±22.3 °C |
| Exact Mass | 278.126648 |
| LogP | 3.71 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | YBLXPWHSKUSOGF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(N=Nc1ccc(OC)cc1)C(C)=O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate |
| Butanoic acid, 2-[(E)-2-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxo-, ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate? |
| A: Molecular weight of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate is 278.304. |
| Q: What is the SMILES notation of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate? |
| A: SMILES notation of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate is CCOC(=O)C(C)(N=Nc1ccc(OC)cc1)C(C)=O. |
| Q: What is the boiling point of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate? |
| A: Boiling point of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate is 353.9±42.0 °C at 760 mmHg. |
| Q: What is the LogP of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate? |
| A: LogP of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate is 3.71. |
| Q: What English synonyms does Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate have? |
| A: English synonyms of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate: Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate, Butanoic acid, 2-[(E)-2-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxo-, ethyl ester. |
| Q: What is the Chinese name of 4792-56-7? |
| A: Chinese name of 4792-56-7 is 4792-56-7. |
| Q: What is the English name of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate? |
| A: The English name of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate is Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate. |
| Q: What is the InChIKey of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate? |
| A: InChIKey of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate is YBLXPWHSKUSOGF-UHFFFAOYSA-N. |
| Q: What is the CAS number of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate? |
| A: CAS number of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate is 4792-56-7. |
| Q: What is the molecular formula of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate? |
| A: Molecular formula of Ethyl 2-[(E)-(4-methoxyphenyl)diazenyl]-2-methyl-3-oxobutanoate is C14H18N2O4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |