(E)-ETHYL 2-(2-(4-METHOXYPHENYL)HYDRAZONO)PROPANOATE
(E)-ETHYL 2-(2-(4-METHOXYPHENYL)HYDRAZONO)PROPANOATE structure
|
Common Name | (E)-ETHYL 2-(2-(4-METHOXYPHENYL)HYDRAZONO)PROPANOATE | ||
|---|---|---|---|---|
| CAS Number | 4792-57-8 | Molecular Weight | 236.26700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16N2O3 |
|---|---|
| Molecular Weight | 236.26700 |
| Exact Mass | 236.11600 |
| PSA | 59.92000 |
| LogP | 2.11910 |
| InChIKey | FILMOULYWLOUCM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)=NNc1ccc(OC)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:4382-54-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (e)-ethyl2-(2-(4-methoxyphenyl)hydrazono)propanoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate have? |
| A: English synonyms of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate: (e)-ethyl2-(2-(4-methoxyphenyl)hydrazono)propanoate. |
| Q: What is the molecular weight of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate? |
| A: Molecular weight of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate is 236.26700. |
| Q: What is the polar surface area (PSA) of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate? |
| A: Polar surface area (PSA) of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate is 59.92000. |
| Q: What are the downstream products of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate? |
| A: Related downstream products(CAS) of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate: 4382-54-1. |
| Q: What is the molecular formula of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate? |
| A: Molecular formula of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate is C12H16N2O3. |
| Q: What is the Chinese name of 4792-57-8? |
| A: Chinese name of 4792-57-8 is 4792-57-8. |
| Q: What is the InChIKey of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate? |
| A: InChIKey of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate is FILMOULYWLOUCM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate? |
| A: SMILES notation of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate is CCOC(=O)C(C)=NNc1ccc(OC)cc1. |
| Q: What is the LogP of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate? |
| A: LogP of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate is 2.11910. |
| Q: What is the English name of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate? |
| A: The English name of ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate is ethyl 2-[2-(4-methoxyphenyl)hydrazinylidene]propanoate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |