tert-butyl 4-(5-formylpyridin-2-yl)piperazine-1-carboxylate structure
|
Common Name | tert-butyl 4-(5-formylpyridin-2-yl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 479226-10-3 | Molecular Weight | 291.34600 | |
| Density | 1.189g/cm3 | Boiling Point | 460.8ºC at 760mmHg | |
| Molecular Formula | C15H21N3O3 | Melting Point | 126ºC | |
| MSDS | N/A | Flash Point | 232.5ºC | |
| Name | tert-butyl 4-(5-formylpyridin-2-yl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 460.8ºC at 760mmHg |
| Melting Point | 126ºC |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.34600 |
| Flash Point | 232.5ºC |
| Exact Mass | 291.15800 |
| PSA | 62.74000 |
| LogP | 1.95410 |
| Index of Refraction | 1.564 |
| InChIKey | NETKWTAEPIGRLQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C=O)cn2)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD08271923 |