1-methyl-2-sulfanylidenequinazolin-4-one
1-methyl-2-sulfanylidenequinazolin-4-one structure
|
Common Name | 1-methyl-2-sulfanylidenequinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 4802-85-1 | Molecular Weight | 192.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methyl-2-sulfanylidenequinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8N2OS |
|---|---|
| Molecular Weight | 192.23800 |
| Exact Mass | 192.03600 |
| PSA | 70.14000 |
| LogP | 2.00840 |
| InChIKey | QYRHSCKVNACOHK-UHFFFAOYSA-N |
| SMILES | Cn1c(=S)[nH]c(=O)c2ccccc21 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:89098-90-8![10-methyl-[1,2,4]triazolo[3,4-b]quinazolin-5-one structure](https://image.chemsrc.com/caspic/475/91511-15-8.png)
CAS#:91511-15-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Methyl-2-thioxo-4-quinazolone |
| 1-methyl-2-thioxoquinazolin-4-one |
| 1-methyl-2-thioxo-2,3-dihydro-1H-quinazolin-4-one |
| 1-Methyl-4-oxo-2-thioxo-1,2,3,4-tetrahydrochinazoline |
| 1-Methyl-4-oxo-2-thioxo-1,2,3,4-tetrahydro-chinazolin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-methyl-2-sulfanylidenequinazolin-4-one? |
| A: InChIKey of 1-methyl-2-sulfanylidenequinazolin-4-one is QYRHSCKVNACOHK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-methyl-2-sulfanylidenequinazolin-4-one? |
| A: SMILES notation of 1-methyl-2-sulfanylidenequinazolin-4-one is Cn1c(=S)[nH]c(=O)c2ccccc21. |
| Q: What English synonyms does 1-methyl-2-sulfanylidenequinazolin-4-one have? |
| A: English synonyms of 1-methyl-2-sulfanylidenequinazolin-4-one: 1-Methyl-2-thioxo-4-quinazolone, 1-methyl-2-thioxoquinazolin-4-one, 1-methyl-2-thioxo-2,3-dihydro-1H-quinazolin-4-one, 1-Methyl-4-oxo-2-thioxo-1,2,3,4-tetrahydrochinazoline, 1-Methyl-4-oxo-2-thioxo-1,2,3,4-tetrahydro-chinazolin. |
| Q: What is the polar surface area (PSA) of 1-methyl-2-sulfanylidenequinazolin-4-one? |
| A: Polar surface area (PSA) of 1-methyl-2-sulfanylidenequinazolin-4-one is 70.14000. |
| Q: What is the Chinese name of 4802-85-1? |
| A: Chinese name of 4802-85-1 is 4802-85-1. |
| Q: What are the downstream products of 1-methyl-2-sulfanylidenequinazolin-4-one? |
| A: Related downstream products(CAS) of 1-methyl-2-sulfanylidenequinazolin-4-one: 89098-90-8;91511-15-8. |
| Q: What is the molecular weight of 1-methyl-2-sulfanylidenequinazolin-4-one? |
| A: Molecular weight of 1-methyl-2-sulfanylidenequinazolin-4-one is 192.23800. |
| Q: What is the LogP of 1-methyl-2-sulfanylidenequinazolin-4-one? |
| A: LogP of 1-methyl-2-sulfanylidenequinazolin-4-one is 2.00840. |
| Q: What is the CAS number of 1-methyl-2-sulfanylidenequinazolin-4-one? |
| A: CAS number of 1-methyl-2-sulfanylidenequinazolin-4-one is 4802-85-1. |
| Q: What is the molecular formula of 1-methyl-2-sulfanylidenequinazolin-4-one? |
| A: Molecular formula of 1-methyl-2-sulfanylidenequinazolin-4-one is C9H8N2OS. |