Ethyl 3-chloro-4-ethoxybenzoate structure
|
Common Name | Ethyl 3-chloro-4-ethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 480439-11-0 | Molecular Weight | 228.67200 | |
| Density | 1.164g/cm3 | Boiling Point | 319.3ºC at 760 mmHg | |
| Molecular Formula | C11H13ClO3 | Melting Point | 49-53ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Name | Ethyl 3-chloro-4-ethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 319.3ºC at 760 mmHg |
| Melting Point | 49-53ºC(lit.) |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67200 |
| Flash Point | >230 °F |
| Exact Mass | 228.05500 |
| PSA | 35.53000 |
| LogP | 2.91540 |
| Index of Refraction | 1.511 |
| InChIKey | KZVDUPODUCECJJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(OCC)c(Cl)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| 3-chloro-4-ethoxy-benzoic acid ethyl ester |
| 4-ethoxy-3-chloro-benzoic acid ethyl ester |
| 3-Chloro-4-ethoxybenzoic acid,ethyl ester |
| MFCD05664242 |
| 4-Aethoxy-3-chlor-benzoesaeure-aethylester |
| 3-Chlor-4-ethoxy-ethyl-benzoat |