5-Chloro-N,N-dimethyl-2-nitrobenzamide structure
|
Common Name | 5-Chloro-N,N-dimethyl-2-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 480451-75-0 | Molecular Weight | 228.632 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 399.4±32.0 °C at 760 mmHg | |
| Molecular Formula | C9H9ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.3±25.1 °C | |
| Name | 5-Chloro-N,N-dimethyl-2-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 399.4±32.0 °C at 760 mmHg |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.632 |
| Flash Point | 195.3±25.1 °C |
| Exact Mass | 228.030167 |
| PSA | 66.13000 |
| LogP | 0.78 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | CMDZDRYXYNKLNL-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1cc(Cl)ccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~%
5-Chloro-N,N-di... CAS#:480451-75-0 |
| Literature: Montagne Recueil des Travaux Chimiques des Pays-Bas, 1900 , vol. 19, p. 55 |
|
~%
5-Chloro-N,N-di... CAS#:480451-75-0 |
| Literature: Hagiwara, Atsushi; Ikenogami, Taku; Kurihara, Kazunori; Taniguchi, Toshio; Takahashi, Mitsuru; Ida, Akio Patent: US2006/89392 A1, 2006 ; Location in patent: Page/Page column 82 ; |
|
~%
5-Chloro-N,N-di... CAS#:480451-75-0 |
| Literature: Montagne Recueil des Travaux Chimiques des Pays-Bas, 1900 , vol. 19, p. 55 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Chloro-N,N-dimethyl-2-nitro-benza; mide |
| 5-Chlor-2-nitro-benzoesaeure-dimethylamid |
| 5-Chloro-N,N-dimethyl-2-nitrobenzamide |
| 5-chloro-2-nitro-benzoic acid dimethylamide |