2,4,6-triaminoheptanedioic acid structure
|
Common Name | 2,4,6-triaminoheptanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 48065-37-8 | Molecular Weight | 205.21200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4,6-triaminoheptanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H15N3O4 |
|---|---|
| Molecular Weight | 205.21200 |
| Exact Mass | 205.10600 |
| PSA | 152.66000 |
| LogP | 0.01860 |
| InChIKey | DYDIAQYPMYZMDR-UHFFFAOYSA-N |
| SMILES | NC(CC(N)C(=O)O)CC(N)C(=O)O |
|
~%
2,4,6-triaminoh... CAS#:48065-37-8 |
| Literature: Hanus,J. et al. Collection of Czechoslovak Chemical Communications, 1973 , vol. 38, p. 1212 - 1220 |
|
~%
2,4,6-triaminoh... CAS#:48065-37-8 |
| Literature: Hanus,J. et al. Collection of Czechoslovak Chemical Communications, 1973 , vol. 38, p. 1212 - 1220 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4,6-Triaminopimelinsaeure |
| Heptanedioic acid,2,4,6-triamino |