(4'-Bromo-4-biphenylyl)boronic acid structure
|
Common Name | (4'-Bromo-4-biphenylyl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 480996-05-2 | Molecular Weight | 276.922 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 430.3±47.0 °C at 760 mmHg | |
| Molecular Formula | C12H10BBrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.0±29.3 °C | |
| Name | 4'-Bromo-4-biphenylboronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 430.3±47.0 °C at 760 mmHg |
| Molecular Formula | C12H10BBrO2 |
| Molecular Weight | 276.922 |
| Flash Point | 214.0±29.3 °C |
| Exact Mass | 275.995728 |
| PSA | 40.46000 |
| LogP | 4.25 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | HQAGDFJHKPSZHT-UHFFFAOYSA-N |
| SMILES | OB(O)c1ccc(-c2ccc(Br)cc2)cc1 |
| HS Code | 2931900090 |
|---|
|
~41%
(4'-Bromo-4-bip... CAS#:480996-05-2 |
| Literature: SEMICONDUCTOR ENERGY LABORATORY CO., LTD. Patent: WO2007/29530 A1, 2007 ; Location in patent: Page/Page column 68-69 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Boronic acid, B-(4'-bromo[1,1'-biphenyl]-4-yl)- |
| (4'-Bromo-4-biphenylyl)boronic acid |
| 4'-BroMo-4-biphenylboronic Acid |
| 4-(4-Bromophenyl)phenylboronic Acid |
| 4-(4-Bromophenyl)benzeneboronic Acid |
| [4-(4-bromophenyl)phenyl]boronic acid |
| (4'-Bromobiphenyl-4-yl)boronic acid |