(3R)-3aβ,5,5a,9bα-Tetrahydro-3,5aα,9-trimethylnaphtho[1,2-b]furan-2,8(3H,4H)-dione
![(3R)-3aβ,5,5a,9bα-Tetrahydro-3,5aα,9-trimethylnaphtho[1,2-b]furan-2,8(3H,4H)-dione Structure](https://image.chemsrc.com/caspic/400/481-07-2.png)
(3R)-3aβ,5,5a,9bα-Tetrahydro-3,5aα,9-trimethylnaphtho[1,2-b]furan-2,8(3H,4H)-dione structure
|
Common Name | (3R)-3aβ,5,5a,9bα-Tetrahydro-3,5aα,9-trimethylnaphtho[1,2-b]furan-2,8(3H,4H)-dione | ||
|---|---|---|---|---|
| CAS Number | 481-07-2 | Molecular Weight | 246.30200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | β-santonin |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H18O3 |
|---|---|
| Molecular Weight | 246.30200 |
| Exact Mass | 246.12600 |
| PSA | 43.37000 |
| LogP | 2.41960 |
| InChIKey | XJHDMGJURBVLLE-OMSPQPPYSA-N |
| SMILES | CC1=C2C3OC(=O)C(C)C3CCC2(C)C=CC1=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![(3,6,9-trimethyl-2-oxo-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-8-yl) acetate structure](https://image.chemsrc.com/caspic/197/14794-69-5.png)
CAS#:14794-69-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| beta-santonin |
| 6.11α(H)-Santonin |
| (11R)-6α-Hydroxy-3-oxo-eudesma-1,4-dien-12-saeure-lacton |
| (11R)-6α-hydroxy-3-oxo-eudesma-1,4-dien-12-oic acid-lactone |
| β-Santonin |
| (-)-β-Santonin |
| α-Santonin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of β-santonin? |
| A: Related downstream products(CAS) of β-santonin: 14794-69-5. |
| Q: What English synonyms does β-santonin have? |
| A: English synonyms of β-santonin: beta-santonin, 6.11α(H)-Santonin, (11R)-6α-Hydroxy-3-oxo-eudesma-1,4-dien-12-saeure-lacton, (11R)-6α-hydroxy-3-oxo-eudesma-1,4-dien-12-oic acid-lactone, β-Santonin, (-)-β-Santonin, α-Santonin. |
| Q: What is the molecular weight of β-santonin? |
| A: Molecular weight of β-santonin is 246.30200. |
| Q: What is the CAS number of β-santonin? |
| A: CAS number of β-santonin is 481-07-2. |
| Q: What is the SMILES notation of β-santonin? |
| A: SMILES notation of β-santonin is CC1=C2C3OC(=O)C(C)C3CCC2(C)C=CC1=O. |
| Q: What is the LogP of β-santonin? |
| A: LogP of β-santonin is 2.41960. |
| Q: What is the InChIKey of β-santonin? |
| A: InChIKey of β-santonin is XJHDMGJURBVLLE-OMSPQPPYSA-N. |
| Q: What is the molecular formula of β-santonin? |
| A: Molecular formula of β-santonin is C15H18O3. |
| Q: What is the Chinese name of 481-07-2? |
| A: Chinese name of 481-07-2 is 481-07-2. |
| Q: What is the English name of β-santonin? |
| A: The English name of β-santonin is β-santonin. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |