Isoreserpic acid
Modify Date: 2026-09-25 18:13:47
Isoreserpic acid structure
|
Common Name | Isoreserpic acid | ||
|---|---|---|---|---|
| CAS Number | 481-65-2 | Molecular Weight | 400.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Isoreserpic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H28N2O5 |
|---|---|
| Molecular Weight | 400.5 |
| InChIKey | JVHNBFFHWQQPLL-PWEWJQQHSA-N |
| SMILES | COc1ccc2c3c([nH]c2c1)C1CC2C(CC(O)C(OC)C2C(=O)O)CN1CC3 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Isoreserpic acid? |
| A: CAS number of Isoreserpic acid is 481-65-2. |
| Q: What is the molecular weight of Isoreserpic acid? |
| A: Molecular weight of Isoreserpic acid is 400.5. |
| Q: What is the molecular formula of Isoreserpic acid? |
| A: Molecular formula of Isoreserpic acid is C22H28N2O5. |
| Q: What is the InChIKey of Isoreserpic acid? |
| A: InChIKey of Isoreserpic acid is JVHNBFFHWQQPLL-PWEWJQQHSA-N. |
| Q: What is the SMILES notation of Isoreserpic acid? |
| A: SMILES notation of Isoreserpic acid is COc1ccc2c3c([nH]c2c1)C1CC2C(CC(O)C(OC)C2C(=O)O)CN1CC3. |
| Q: What is the English name of Isoreserpic acid? |
| A: The English name of Isoreserpic acid is Isoreserpic acid. |
| Q: What is the Chinese name of 481-65-2? |
| A: Chinese name of 481-65-2 is 481-65-2. |