5-oxoproline, compound with (carboxylatomethyl)trimethylammonium (1:1) structure
|
Common Name | 5-oxoproline, compound with (carboxylatomethyl)trimethylammonium (1:1) | ||
|---|---|---|---|---|
| CAS Number | 4810-57-5 | Molecular Weight | 246.260 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (Trimethylammonio)acetate-5-oxoproline (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H18N2O5 |
|---|---|
| Molecular Weight | 246.260 |
| Exact Mass | 246.121567 |
| InChIKey | WOPICKJSMWPYCA-DFWYDOINSA-N |
| SMILES | C[N+](C)(C)CC(=O)[O-].O=C1CCC(C(=O)O)N1 |
| Proline, 5-oxo-, ion(1-), 1-carboxy-N,N,N-trimethylmethanaminium |
| (Trimethylammonio)acetate - 5-oxoproline (1:1) |
| EINECS 225-374-4 |