Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate
Modify Date: 2025-08-29 12:12:42
Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate structure
|
Common Name | Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate | ||
|---|---|---|---|---|
| CAS Number | 481053-33-2 | Molecular Weight | 322.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21F2O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H21F2O4P |
|---|---|
| Molecular Weight | 322.28 |
| InChIKey | OOUSHVCDMBTSCX-ZDUSSCGKSA-N |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(O)CCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 481053-33-2? |
| A: Chinese name of 481053-33-2 is 481053-33-2. |
| Q: What is the CAS number of Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate? |
| A: CAS number of Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate is 481053-33-2. |
| Q: What is the InChIKey of Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate? |
| A: InChIKey of Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate is OOUSHVCDMBTSCX-ZDUSSCGKSA-N. |
| Q: What is the English name of Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate? |
| A: The English name of Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate is Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate. |
| Q: What is the molecular weight of Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate? |
| A: Molecular weight of Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate is 322.28. |
| Q: What is the SMILES notation of Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate? |
| A: SMILES notation of Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate is CCOP(=O)(OCC)C(F)(F)C(O)CCc1ccccc1. |
| Q: What is the molecular formula of Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate? |
| A: Molecular formula of Diethyl (1,1-difluoro-2-hydroxy-4-phenylbutyl)phosphonate is C14H21F2O4P. |