4-Pyridinecarboxylicacid, 2-(1-methyl-3-phenyl-2-propen-1-ylidene)hydrazide structure
|
Common Name | 4-Pyridinecarboxylicacid, 2-(1-methyl-3-phenyl-2-propen-1-ylidene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 4813-12-1 | Molecular Weight | 265.31000 | |
| Density | 1.08g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-phenylbut-3-en-2-ylideneamino)pyridine-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.31000 |
| Exact Mass | 265.12200 |
| PSA | 54.35000 |
| LogP | 3.29160 |
| Index of Refraction | 1.579 |
| InChIKey | COSOIDVYPRKBNX-JZYRRUABSA-N |
| SMILES | CC(C=Cc1ccccc1)=NNC(=O)c1ccncc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Isonicotinicacid,(a-methylcinnamylidene)hydrazide(6CI,7CI,8CI) |
| isonicotinic acid-(1-methyl-3t-phenyl-allylidenehydrazide) |
| 4-Pyridinecarboxylicacid,2-(1-methyl-3-phenyl-2-propen-1-ylidene)hydrazide |
| N-[[(E)-4-phenylbut-3-en-2-ylidene]amino]pyridine-4-carboxamide |
| Isonicotinsaeure-(1-methyl-3t-phenyl-allylidenhydrazid) |