Benzenepropanamine,4-chloro-a-methyl-b-phenyl-, hydrochloride (1:1) structure
|
Common Name | Benzenepropanamine,4-chloro-a-methyl-b-phenyl-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 4814-11-3 | Molecular Weight | 296.23500 | |
| Density | 1.116g/cm3 | Boiling Point | 353.7ºC at 760mmHg | |
| Molecular Formula | C16H19Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.7ºC | |
| Name | 4-(4-chlorophenyl)-3-phenylbutan-2-amine,hydrochloride |
|---|
| Density | 1.116g/cm3 |
|---|---|
| Boiling Point | 353.7ºC at 760mmHg |
| Molecular Formula | C16H19Cl2N |
| Molecular Weight | 296.23500 |
| Flash Point | 207.7ºC |
| Exact Mass | 295.08900 |
| PSA | 26.02000 |
| LogP | 5.51580 |
| Index of Refraction | 1.584 |
| InChIKey | FRMQIGNMWCKPMD-UHFFFAOYSA-N |
| SMILES | CC(N)C(Cc1ccc(Cl)cc1)c1ccccc1.Cl |
|
~%
Benzenepropanam... CAS#:4814-11-3 |
| Literature: MERCK and CO., INC. Patent: WO2005/27837 A2, 2005 ; Location in patent: Page/Page column 42; 45 ; WO 2005/027837 A2 |