Homoferreirin
Homoferreirin structure
|
Common Name | Homoferreirin | ||
|---|---|---|---|---|
| CAS Number | 482-01-9 | Molecular Weight | 316.305 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 557.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.0±23.6 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | homoferreirin |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 557.4±50.0 °C at 760 mmHg |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.305 |
| Flash Point | 208.0±23.6 °C |
| Exact Mass | 316.094696 |
| PSA | 85.22000 |
| LogP | 3.67 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | LMLDNMHDNFCNCW-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2COc3cc(O)cc(O)c3C2=O)c(OC)c1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-(2,4-Dimethoxyphenyl)-5,7-dihydroxy-2,3-dihydro-4H-chromen-4-one |
| Homoferreirin,5,7-Dihydroxy-2',4'-dimethoxy-isoflavanon |
| 5,7-Dihydroxy-2',4'-dimethoxy-isoflavanon |
| 3-(2,4-dimethoxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one |
| Homoferreirin |
| 5,7-dihydroxy-2',4'-dimethoxyisoflavanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of homoferreirin? |
| A: Molecular weight of homoferreirin is 316.305. |
| Q: What is the molecular formula of homoferreirin? |
| A: Molecular formula of homoferreirin is C17H16O6. |
| Q: What is the polar surface area (PSA) of homoferreirin? |
| A: Polar surface area (PSA) of homoferreirin is 85.22000. |
| Q: What is the LogP of homoferreirin? |
| A: LogP of homoferreirin is 3.67. |
| Q: What is the boiling point of homoferreirin? |
| A: Boiling point of homoferreirin is 557.4±50.0 °C at 760 mmHg. |
| Q: What is the InChIKey of homoferreirin? |
| A: InChIKey of homoferreirin is LMLDNMHDNFCNCW-UHFFFAOYSA-N. |
| Q: What is the English name of homoferreirin? |
| A: The English name of homoferreirin is homoferreirin. |
| Q: What English synonyms does homoferreirin have? |
| A: English synonyms of homoferreirin: 3-(2,4-Dimethoxyphenyl)-5,7-dihydroxy-2,3-dihydro-4H-chromen-4-one, Homoferreirin,5,7-Dihydroxy-2',4'-dimethoxy-isoflavanon, 5,7-Dihydroxy-2',4'-dimethoxy-isoflavanon, 3-(2,4-dimethoxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one, Homoferreirin, 5,7-dihydroxy-2',4'-dimethoxyisoflavanone. |
| Q: What is the SMILES notation of homoferreirin? |
| A: SMILES notation of homoferreirin is COc1ccc(C2COc3cc(O)cc(O)c3C2=O)c(OC)c1. |
| Q: What is the CAS number of homoferreirin? |
| A: CAS number of homoferreirin is 482-01-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| BioBioPha |
| Dayang Chem (Hangzhou) Co., Ltd. |
| naturewill |